C8H16N4O2S — CID 106069679
N-(1H-imidazol-5-ylmethyl)-3-(methylamino)propane-1-sulfonamide (PubChem CID 106069679) has the molecular formula C8H16N4O2S and a molecular weight of 232.31 g/mol. Its IUPAC name is N-(1H-imidazol-5-ylmethyl)-3-(methylamino)propane-1-sulfonamide.
| Compound Name | N-(1H-imidazol-5-ylmethyl)-3-(methylamino)propane-1-sulfonamide |
|---|---|
| PubChem CID | 106069679 |
| Molecular Formula | C8H16N4O2S |
| Molecular Weight | 232.31 g/mol |
| Exact Mass | 232.10 |
| IUPAC Name | N-(1H-imidazol-5-ylmethyl)-3-(methylamino)propane-1-sulfonamide |
| SMILES | CNCCCS(=O)(=O)NCc1cnc[nH]1 |
| InChI | InChI=1S/C8H16N4O2S/c1-9-3-2-4-15(13,14)12-6-8-5-10-7-11-8/h5,7,9,12H,2-4,6H2,1H3,(H,10,11) |
| InChIKey | IBFHGQGITKLQLC-UHFFFAOYSA-N |
| XLogP | -0.56 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.31 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|