C14H18ClN3O2S — CID 18314087
N-[(4-chlorophenyl)methyl]-4-(1H-imidazol-5-yl)butane-1-sulfonamide (PubChem CID 18314087) has the molecular formula C14H18ClN3O2S and a molecular weight of 327.84 g/mol. Its IUPAC name is N-[(4-chlorophenyl)methyl]-4-(1H-imidazol-5-yl)butane-1-sulfonamide.
| Compound Name | N-[(4-chlorophenyl)methyl]-4-(1H-imidazol-5-yl)butane-1-sulfonamide |
|---|---|
| PubChem CID | 18314087 |
| Molecular Formula | C14H18ClN3O2S |
| Molecular Weight | 327.84 g/mol |
| Exact Mass | 327.08 |
| IUPAC Name | N-[(4-chlorophenyl)methyl]-4-(1H-imidazol-5-yl)butane-1-sulfonamide |
| SMILES | O=S(=O)(CCCCc1cnc[nH]1)NCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C14H18ClN3O2S/c15-13-6-4-12(5-7-13)9-18-21(19,20)8-2-1-3-14-10-16-11-17-14/h4-7,10-11,18H,1-3,8-9H2,(H,16,17) |
| InChIKey | BSZWNIMJNAZBQZ-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.84 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|