C18H18ClN3O2S — CID 22450062
1-(4-chlorophenyl)-N-[[4-(1H-imidazol-5-ylmethyl)phenyl]methyl]methanesulfonamide (PubChem CID 22450062) has the molecular formula C18H18ClN3O2S and a molecular weight of 375.88 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-N-[[4-(1H-imidazol-5-ylmethyl)phenyl]methyl]methanesulfonamide.
| Compound Name | 1-(4-chlorophenyl)-N-[[4-(1H-imidazol-5-ylmethyl)phenyl]methyl]methanesulfonamide |
|---|---|
| PubChem CID | 22450062 |
| Molecular Formula | C18H18ClN3O2S |
| Molecular Weight | 375.88 g/mol |
| Exact Mass | 375.08 |
| IUPAC Name | 1-(4-chlorophenyl)-N-[[4-(1H-imidazol-5-ylmethyl)phenyl]methyl]methanesulfonamide |
| SMILES | O=S(=O)(Cc1ccc(Cl)cc1)NCc1ccc(Cc2cnc[nH]2)cc1 |
| InChI | InChI=1S/C18H18ClN3O2S/c19-17-7-5-16(6-8-17)12-25(23,24)22-10-15-3-1-14(2-4-15)9-18-11-20-13-21-18/h1-8,11,13,22H,9-10,12H2,(H,20,21) |
| InChIKey | LLTJAVRIBFYCRQ-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.88 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |