C8H17N5O2S — CID 106013145
4-(methylamino)-N-(1H-1,2,4-triazol-5-ylmethyl)butane-1-sulfonamide (PubChem CID 106013145) has the molecular formula C8H17N5O2S and a molecular weight of 247.32 g/mol. Its IUPAC name is 4-(methylamino)-N-(1H-1,2,4-triazol-5-ylmethyl)butane-1-sulfonamide.
| Compound Name | 4-(methylamino)-N-(1H-1,2,4-triazol-5-ylmethyl)butane-1-sulfonamide |
|---|---|
| PubChem CID | 106013145 |
| Molecular Formula | C8H17N5O2S |
| Molecular Weight | 247.32 g/mol |
| Exact Mass | 247.11 |
| IUPAC Name | 4-(methylamino)-N-(1H-1,2,4-triazol-5-ylmethyl)butane-1-sulfonamide |
| SMILES | CNCCCCS(=O)(=O)NCc1ncn[nH]1 |
| InChI | InChI=1S/C8H17N5O2S/c1-9-4-2-3-5-16(14,15)12-6-8-10-7-11-13-8/h7,9,12H,2-6H2,1H3,(H,10,11,13) |
| InChIKey | WYTINPJVJNDDNW-UHFFFAOYSA-N |
| XLogP | -0.78 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.32 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|