methyl 2-(1H-1,2,4-triazol-5-ylmethylsulfamoyl)acetate

C6H10N4O4S — CID 61456841

IUPACmethyl 2-(1H-1,2,4-triazol-5-ylmethylsulfamoyl)acetate
SMILESCOC(=O)CS(=O)(=O)NCc1ncn[nH]1
InChIInChI=1S/C6H10N4O4S/c1-14-6(11)3-15(12,13)9-2-5-7-4-8-10-5/h4,9H,2-3H2,1H3,(H,7,8,10)
InChIKeyUQYYEZZFEPOMEP-UHFFFAOYSA-N
MW234.24 g/mol
LogP-1.60
Rot. Bonds5

About methyl 2-(1H-1,2,4-triazol-5-ylmethylsulfamoyl)acetate

methyl 2-(1H-1,2,4-triazol-5-ylmethylsulfamoyl)acetate (PubChem CID 61456841) has the molecular formula C6H10N4O4S and a molecular weight of 234.24 g/mol. Its IUPAC name is methyl 2-(1H-1,2,4-triazol-5-ylmethylsulfamoyl)acetate.

Molecular Properties

Compound Namemethyl 2-(1H-1,2,4-triazol-5-ylmethylsulfamoyl)acetate
PubChem CID61456841
Molecular FormulaC6H10N4O4S
Molecular Weight234.24 g/mol
Exact Mass234.04
IUPAC Namemethyl 2-(1H-1,2,4-triazol-5-ylmethylsulfamoyl)acetate
SMILESCOC(=O)CS(=O)(=O)NCc1ncn[nH]1
InChIInChI=1S/C6H10N4O4S/c1-14-6(11)3-15(12,13)9-2-5-7-4-8-10-5/h4,9H,2-3H2,1H3,(H,7,8,10)
InChIKeyUQYYEZZFEPOMEP-UHFFFAOYSA-N
XLogP-1.60
TPSA114.04 Ų
H-Bond Donors2
H-Bond Acceptors6
Rotatable Bonds5
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500234.24
LogP ≤ 5-1.60
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 106

Analyze methyl 2-(1H-1,2,4-triazol-5-ylmethylsulfamoyl)acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-(1H-1,2,4-triazol-5-ylmethylsulfamoyl)acetate?
The IUPAC name of methyl 2-(1H-1,2,4-triazol-5-ylmethylsulfamoyl)acetate (CID 61456841) is methyl 2-(1H-1,2,4-triazol-5-ylmethylsulfamoyl)acetate.
What is the SMILES notation for methyl 2-(1H-1,2,4-triazol-5-ylmethylsulfamoyl)acetate?
The canonical SMILES for methyl 2-(1H-1,2,4-triazol-5-ylmethylsulfamoyl)acetate is COC(=O)CS(=O)(=O)NCc1ncn[nH]1.
What is the InChIKey of methyl 2-(1H-1,2,4-triazol-5-ylmethylsulfamoyl)acetate?
The InChIKey is UQYYEZZFEPOMEP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N4O4S/c1-14-6(11)3-15(12,13)9-2-5-7-4-8-10-5/h4,9H,2-3H2,1H3,(H,7,8,10).
What are the key properties of methyl 2-(1H-1,2,4-triazol-5-ylmethylsulfamoyl)acetate?
methyl 2-(1H-1,2,4-triazol-5-ylmethylsulfamoyl)acetate has a molecular weight of 234.24 g/mol, XLogP of -1.60, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(1H-1,2,4-triazol-5-ylmethylsulfamoyl)acetate is sourced from PubChem (CID 61456841), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).