C6H10N4O4S — CID 61456841
methyl 2-(1H-1,2,4-triazol-5-ylmethylsulfamoyl)acetate (PubChem CID 61456841) has the molecular formula C6H10N4O4S and a molecular weight of 234.24 g/mol. Its IUPAC name is methyl 2-(1H-1,2,4-triazol-5-ylmethylsulfamoyl)acetate.
| Compound Name | methyl 2-(1H-1,2,4-triazol-5-ylmethylsulfamoyl)acetate |
|---|---|
| PubChem CID | 61456841 |
| Molecular Formula | C6H10N4O4S |
| Molecular Weight | 234.24 g/mol |
| Exact Mass | 234.04 |
| IUPAC Name | methyl 2-(1H-1,2,4-triazol-5-ylmethylsulfamoyl)acetate |
| SMILES | COC(=O)CS(=O)(=O)NCc1ncn[nH]1 |
| InChI | InChI=1S/C6H10N4O4S/c1-14-6(11)3-15(12,13)9-2-5-7-4-8-10-5/h4,9H,2-3H2,1H3,(H,7,8,10) |
| InChIKey | UQYYEZZFEPOMEP-UHFFFAOYSA-N |
| XLogP | -1.60 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.24 |
| LogP ≤ 5 | -1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |