C9H19N5O2S — CID 114137262
3-(propylamino)-N-(1H-1,2,4-triazol-5-ylmethyl)propane-1-sulfonamide (PubChem CID 114137262) has the molecular formula C9H19N5O2S and a molecular weight of 261.35 g/mol. Its IUPAC name is 3-(propylamino)-N-(1H-1,2,4-triazol-5-ylmethyl)propane-1-sulfonamide.
| Compound Name | 3-(propylamino)-N-(1H-1,2,4-triazol-5-ylmethyl)propane-1-sulfonamide |
|---|---|
| PubChem CID | 114137262 |
| Molecular Formula | C9H19N5O2S |
| Molecular Weight | 261.35 g/mol |
| Exact Mass | 261.13 |
| IUPAC Name | 3-(propylamino)-N-(1H-1,2,4-triazol-5-ylmethyl)propane-1-sulfonamide |
| SMILES | CCCNCCCS(=O)(=O)NCc1ncn[nH]1 |
| InChI | InChI=1S/C9H19N5O2S/c1-2-4-10-5-3-6-17(15,16)13-7-9-11-8-12-14-9/h8,10,13H,2-7H2,1H3,(H,11,12,14) |
| InChIKey | CWIRVIWHJJLBQR-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.35 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|