C12H18N6O2S — CID 106013375
5-(propylaminomethyl)-N-(1H-1,2,4-triazol-5-ylmethyl)pyridine-2-sulfonamide (PubChem CID 106013375) has the molecular formula C12H18N6O2S and a molecular weight of 310.38 g/mol. Its IUPAC name is 5-(propylaminomethyl)-N-(1H-1,2,4-triazol-5-ylmethyl)pyridine-2-sulfonamide.
| Compound Name | 5-(propylaminomethyl)-N-(1H-1,2,4-triazol-5-ylmethyl)pyridine-2-sulfonamide |
|---|---|
| PubChem CID | 106013375 |
| Molecular Formula | C12H18N6O2S |
| Molecular Weight | 310.38 g/mol |
| Exact Mass | 310.12 |
| IUPAC Name | 5-(propylaminomethyl)-N-(1H-1,2,4-triazol-5-ylmethyl)pyridine-2-sulfonamide |
| SMILES | CCCNCc1ccc(S(=O)(=O)NCc2ncn[nH]2)nc1 |
| InChI | InChI=1S/C12H18N6O2S/c1-2-5-13-6-10-3-4-12(14-7-10)21(19,20)17-8-11-15-9-16-18-11/h3-4,7,9,13,17H,2,5-6,8H2,1H3,(H,15,16,18) |
| InChIKey | SFGMULIINMENGU-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 112.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.38 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|