C14H26N4O2S — CID 106017285
N-[2-(dimethylamino)propyl]-5-(propylaminomethyl)pyridine-2-sulfonamide (PubChem CID 106017285) has the molecular formula C14H26N4O2S and a molecular weight of 314.46 g/mol. Its IUPAC name is N-[2-(dimethylamino)propyl]-5-(propylaminomethyl)pyridine-2-sulfonamide.
| Compound Name | N-[2-(dimethylamino)propyl]-5-(propylaminomethyl)pyridine-2-sulfonamide |
|---|---|
| PubChem CID | 106017285 |
| Molecular Formula | C14H26N4O2S |
| Molecular Weight | 314.46 g/mol |
| Exact Mass | 314.18 |
| IUPAC Name | N-[2-(dimethylamino)propyl]-5-(propylaminomethyl)pyridine-2-sulfonamide |
| SMILES | CCCNCc1ccc(S(=O)(=O)NCC(C)N(C)C)nc1 |
| InChI | InChI=1S/C14H26N4O2S/c1-5-8-15-10-13-6-7-14(16-11-13)21(19,20)17-9-12(2)18(3)4/h6-7,11-12,15,17H,5,8-10H2,1-4H3 |
| InChIKey | SYNTUOCXUMKYPK-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.46 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|