C14H23N3O3S — CID 82749058
N-methyl-N-(oxolan-3-yl)-5-(propylaminomethyl)pyridine-2-sulfonamide (PubChem CID 82749058) has the molecular formula C14H23N3O3S and a molecular weight of 313.42 g/mol. Its IUPAC name is N-methyl-N-(oxolan-3-yl)-5-(propylaminomethyl)pyridine-2-sulfonamide.
| Compound Name | N-methyl-N-(oxolan-3-yl)-5-(propylaminomethyl)pyridine-2-sulfonamide |
|---|---|
| PubChem CID | 82749058 |
| Molecular Formula | C14H23N3O3S |
| Molecular Weight | 313.42 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | N-methyl-N-(oxolan-3-yl)-5-(propylaminomethyl)pyridine-2-sulfonamide |
| SMILES | CCCNCc1ccc(S(=O)(=O)N(C)C2CCOC2)nc1 |
| InChI | InChI=1S/C14H23N3O3S/c1-3-7-15-9-12-4-5-14(16-10-12)21(18,19)17(2)13-6-8-20-11-13/h4-5,10,13,15H,3,6-9,11H2,1-2H3 |
| InChIKey | OSTSHOGXQRCLRK-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.42 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|