C12H27N3O3S — CID 82745275
N'-methyl-N'-[methyl(oxolan-3-yl)sulfamoyl]-N-propylpropane-1,3-diamine (PubChem CID 82745275) has the molecular formula C12H27N3O3S and a molecular weight of 293.43 g/mol. Its IUPAC name is N'-methyl-N'-[methyl(oxolan-3-yl)sulfamoyl]-N-propylpropane-1,3-diamine.
| Compound Name | N'-methyl-N'-[methyl(oxolan-3-yl)sulfamoyl]-N-propylpropane-1,3-diamine |
|---|---|
| PubChem CID | 82745275 |
| Molecular Formula | C12H27N3O3S |
| Molecular Weight | 293.43 g/mol |
| Exact Mass | 293.18 |
| IUPAC Name | N'-methyl-N'-[methyl(oxolan-3-yl)sulfamoyl]-N-propylpropane-1,3-diamine |
| SMILES | CCCNCCCN(C)S(=O)(=O)N(C)C1CCOC1 |
| InChI | InChI=1S/C12H27N3O3S/c1-4-7-13-8-5-9-14(2)19(16,17)15(3)12-6-10-18-11-12/h12-13H,4-11H2,1-3H3 |
| InChIKey | HBDBJEYFASUUPP-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.43 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|