C13H29N3O2S — CID 106091151
2-[[methyl-[3-(propylamino)propyl]sulfamoyl]amino]propan-2-ylcyclopropane (PubChem CID 106091151) has the molecular formula C13H29N3O2S and a molecular weight of 291.46 g/mol. Its IUPAC name is 2-[[methyl-[3-(propylamino)propyl]sulfamoyl]amino]propan-2-ylcyclopropane.
| Compound Name | 2-[[methyl-[3-(propylamino)propyl]sulfamoyl]amino]propan-2-ylcyclopropane |
|---|---|
| PubChem CID | 106091151 |
| Molecular Formula | C13H29N3O2S |
| Molecular Weight | 291.46 g/mol |
| Exact Mass | 291.20 |
| IUPAC Name | 2-[[methyl-[3-(propylamino)propyl]sulfamoyl]amino]propan-2-ylcyclopropane |
| SMILES | CCCNCCCN(C)S(=O)(=O)NC(C)(C)C1CC1 |
| InChI | InChI=1S/C13H29N3O2S/c1-5-9-14-10-6-11-16(4)19(17,18)15-13(2,3)12-7-8-12/h12,14-15H,5-11H2,1-4H3 |
| InChIKey | WJVHYAAEKYLXSZ-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.46 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|