C13H29N3O4S — CID 103541529
3,4-dimethoxy-N-methyl-N-[3-(propylamino)propyl]pyrrolidine-1-sulfonamide (PubChem CID 103541529) has the molecular formula C13H29N3O4S and a molecular weight of 323.46 g/mol. Its IUPAC name is 3,4-dimethoxy-N-methyl-N-[3-(propylamino)propyl]pyrrolidine-1-sulfonamide.
| Compound Name | 3,4-dimethoxy-N-methyl-N-[3-(propylamino)propyl]pyrrolidine-1-sulfonamide |
|---|---|
| PubChem CID | 103541529 |
| Molecular Formula | C13H29N3O4S |
| Molecular Weight | 323.46 g/mol |
| Exact Mass | 323.19 |
| IUPAC Name | 3,4-dimethoxy-N-methyl-N-[3-(propylamino)propyl]pyrrolidine-1-sulfonamide |
| SMILES | CCCNCCCN(C)S(=O)(=O)N1CC(OC)C(OC)C1 |
| InChI | InChI=1S/C13H29N3O4S/c1-5-7-14-8-6-9-15(2)21(17,18)16-10-12(19-3)13(11-16)20-4/h12-14H,5-11H2,1-4H3 |
| InChIKey | REQIJKZDAFCJLE-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.46 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|