C13H27N3O2S — CID 106317296
N,5-dimethyl-N-[3-(propylamino)propyl]-3,6-dihydro-2H-pyridine-1-sulfonamide (PubChem CID 106317296) has the molecular formula C13H27N3O2S and a molecular weight of 289.45 g/mol. Its IUPAC name is N,5-dimethyl-N-[3-(propylamino)propyl]-3,6-dihydro-2H-pyridine-1-sulfonamide.
| Compound Name | N,5-dimethyl-N-[3-(propylamino)propyl]-3,6-dihydro-2H-pyridine-1-sulfonamide |
|---|---|
| PubChem CID | 106317296 |
| Molecular Formula | C13H27N3O2S |
| Molecular Weight | 289.45 g/mol |
| Exact Mass | 289.18 |
| IUPAC Name | N,5-dimethyl-N-[3-(propylamino)propyl]-3,6-dihydro-2H-pyridine-1-sulfonamide |
| SMILES | CCCNCCCN(C)S(=O)(=O)N1CCC=C(C)C1 |
| InChI | InChI=1S/C13H27N3O2S/c1-4-8-14-9-6-10-15(3)19(17,18)16-11-5-7-13(2)12-16/h7,14H,4-6,8-12H2,1-3H3 |
| InChIKey | XTOJKSHQICCZLN-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.45 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|