C11H20N2O4S — CID 106313446
methyl 3-[methyl-[(5-methyl-3,6-dihydro-2H-pyridin-1-yl)sulfonyl]amino]propanoate (PubChem CID 106313446) has the molecular formula C11H20N2O4S and a molecular weight of 276.36 g/mol. Its IUPAC name is methyl 3-[methyl-[(5-methyl-3,6-dihydro-2H-pyridin-1-yl)sulfonyl]amino]propanoate.
| Compound Name | methyl 3-[methyl-[(5-methyl-3,6-dihydro-2H-pyridin-1-yl)sulfonyl]amino]propanoate |
|---|---|
| PubChem CID | 106313446 |
| Molecular Formula | C11H20N2O4S |
| Molecular Weight | 276.36 g/mol |
| Exact Mass | 276.11 |
| IUPAC Name | methyl 3-[methyl-[(5-methyl-3,6-dihydro-2H-pyridin-1-yl)sulfonyl]amino]propanoate |
| SMILES | COC(=O)CCN(C)S(=O)(=O)N1CCC=C(C)C1 |
| InChI | InChI=1S/C11H20N2O4S/c1-10-5-4-7-13(9-10)18(15,16)12(2)8-6-11(14)17-3/h5H,4,6-9H2,1-3H3 |
| InChIKey | KHKQEZTXWUBJAG-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.36 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|