C11H23N3O4S — CID 120777156
methyl 3-[[3-(aminomethyl)-3-methylpyrrolidin-1-yl]sulfonyl-methylamino]propanoate (PubChem CID 120777156) has the molecular formula C11H23N3O4S and a molecular weight of 293.39 g/mol. Its IUPAC name is methyl 3-[[3-(aminomethyl)-3-methylpyrrolidin-1-yl]sulfonyl-methylamino]propanoate.
| Compound Name | methyl 3-[[3-(aminomethyl)-3-methylpyrrolidin-1-yl]sulfonyl-methylamino]propanoate |
|---|---|
| PubChem CID | 120777156 |
| Molecular Formula | C11H23N3O4S |
| Molecular Weight | 293.39 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | methyl 3-[[3-(aminomethyl)-3-methylpyrrolidin-1-yl]sulfonyl-methylamino]propanoate |
| SMILES | COC(=O)CCN(C)S(=O)(=O)N1CCC(C)(CN)C1 |
| InChI | InChI=1S/C11H23N3O4S/c1-11(8-12)5-7-14(9-11)19(16,17)13(2)6-4-10(15)18-3/h4-9,12H2,1-3H3 |
| InChIKey | BBYUTEHSAHRIPE-UHFFFAOYSA-N |
| XLogP | -0.60 |
| TPSA | 92.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.39 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |