C10H21N3O4S — CID 83004152
methyl 3-[methyl(piperidin-1-ylsulfamoyl)amino]propanoate (PubChem CID 83004152) has the molecular formula C10H21N3O4S and a molecular weight of 279.36 g/mol. Its IUPAC name is methyl 3-[methyl(piperidin-1-ylsulfamoyl)amino]propanoate.
| Compound Name | methyl 3-[methyl(piperidin-1-ylsulfamoyl)amino]propanoate |
|---|---|
| PubChem CID | 83004152 |
| Molecular Formula | C10H21N3O4S |
| Molecular Weight | 279.36 g/mol |
| Exact Mass | 279.13 |
| IUPAC Name | methyl 3-[methyl(piperidin-1-ylsulfamoyl)amino]propanoate |
| SMILES | COC(=O)CCN(C)S(=O)(=O)NN1CCCCC1 |
| InChI | InChI=1S/C10H21N3O4S/c1-12(9-6-10(14)17-2)18(15,16)11-13-7-4-3-5-8-13/h11H,3-9H2,1-2H3 |
| InChIKey | CNQZQZLYXMPFHQ-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.36 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |