C14H32N4O2S — CID 81463759
3-(dimethylamino)-N,4-dimethyl-N-[3-(propylamino)propyl]pyrrolidine-1-sulfonamide (PubChem CID 81463759) has the molecular formula C14H32N4O2S and a molecular weight of 320.50 g/mol. Its IUPAC name is 3-(dimethylamino)-N,4-dimethyl-N-[3-(propylamino)propyl]pyrrolidine-1-sulfonamide.
| Compound Name | 3-(dimethylamino)-N,4-dimethyl-N-[3-(propylamino)propyl]pyrrolidine-1-sulfonamide |
|---|---|
| PubChem CID | 81463759 |
| Molecular Formula | C14H32N4O2S |
| Molecular Weight | 320.50 g/mol |
| Exact Mass | 320.22 |
| IUPAC Name | 3-(dimethylamino)-N,4-dimethyl-N-[3-(propylamino)propyl]pyrrolidine-1-sulfonamide |
| SMILES | CCCNCCCN(C)S(=O)(=O)N1CC(C)C(N(C)C)C1 |
| InChI | InChI=1S/C14H32N4O2S/c1-6-8-15-9-7-10-17(5)21(19,20)18-11-13(2)14(12-18)16(3)4/h13-15H,6-12H2,1-5H3 |
| InChIKey | JQKCFWOYNHPNRK-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.50 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|