C11H19N7O2S — CID 106013151
1-[2-(propylamino)ethyl]-N-(1H-1,2,4-triazol-5-ylmethyl)pyrazole-4-sulfonamide (PubChem CID 106013151) has the molecular formula C11H19N7O2S and a molecular weight of 313.39 g/mol. Its IUPAC name is 1-[2-(propylamino)ethyl]-N-(1H-1,2,4-triazol-5-ylmethyl)pyrazole-4-sulfonamide.
| Compound Name | 1-[2-(propylamino)ethyl]-N-(1H-1,2,4-triazol-5-ylmethyl)pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 106013151 |
| Molecular Formula | C11H19N7O2S |
| Molecular Weight | 313.39 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | 1-[2-(propylamino)ethyl]-N-(1H-1,2,4-triazol-5-ylmethyl)pyrazole-4-sulfonamide |
| SMILES | CCCNCCn1cc(S(=O)(=O)NCc2ncn[nH]2)cn1 |
| InChI | InChI=1S/C11H19N7O2S/c1-2-3-12-4-5-18-8-10(6-15-18)21(19,20)16-7-11-13-9-14-17-11/h6,8-9,12,16H,2-5,7H2,1H3,(H,13,14,17) |
| InChIKey | PJSYHIPPWGOXJC-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 117.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.39 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|