C8H17N5O2S — CID 60982439
5-[[[butyl(methyl)sulfamoyl]amino]methyl]-1H-1,2,4-triazole (PubChem CID 60982439) has the molecular formula C8H17N5O2S and a molecular weight of 247.32 g/mol. Its IUPAC name is 5-[[[butyl(methyl)sulfamoyl]amino]methyl]-1H-1,2,4-triazole.
| Compound Name | 5-[[[butyl(methyl)sulfamoyl]amino]methyl]-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 60982439 |
| Molecular Formula | C8H17N5O2S |
| Molecular Weight | 247.32 g/mol |
| Exact Mass | 247.11 |
| IUPAC Name | 5-[[[butyl(methyl)sulfamoyl]amino]methyl]-1H-1,2,4-triazole |
| SMILES | CCCCN(C)S(=O)(=O)NCc1ncn[nH]1 |
| InChI | InChI=1S/C8H17N5O2S/c1-3-4-5-13(2)16(14,15)11-6-8-9-7-10-12-8/h7,11H,3-6H2,1-2H3,(H,9,10,12) |
| InChIKey | HPUQZLAJFLLUAV-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.32 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |