C10H20N4O2S — CID 4018351
N,N-dibutyl-1H-1,2,4-triazole-5-sulfonamide (PubChem CID 4018351) has the molecular formula C10H20N4O2S and a molecular weight of 260.36 g/mol. Its IUPAC name is N,N-dibutyl-1H-1,2,4-triazole-5-sulfonamide.
| Compound Name | N,N-dibutyl-1H-1,2,4-triazole-5-sulfonamide |
|---|---|
| PubChem CID | 4018351 |
| Molecular Formula | C10H20N4O2S |
| Molecular Weight | 260.36 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | N,N-dibutyl-1H-1,2,4-triazole-5-sulfonamide |
| SMILES | CCCCN(CCCC)S(=O)(=O)c1ncn[nH]1 |
| InChI | InChI=1S/C10H20N4O2S/c1-3-5-7-14(8-6-4-2)17(15,16)10-11-9-12-13-10/h9H,3-8H2,1-2H3,(H,11,12,13) |
| InChIKey | QNCNGPWWSYJFRI-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.36 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |