C11H19ClN2O2S2 — CID 43455931
N,N-dibutyl-2-chloro-1,3-thiazole-5-sulfonamide (PubChem CID 43455931) has the molecular formula C11H19ClN2O2S2 and a molecular weight of 310.87 g/mol. Its IUPAC name is N,N-dibutyl-2-chloro-1,3-thiazole-5-sulfonamide.
| Compound Name | N,N-dibutyl-2-chloro-1,3-thiazole-5-sulfonamide |
|---|---|
| PubChem CID | 43455931 |
| Molecular Formula | C11H19ClN2O2S2 |
| Molecular Weight | 310.87 g/mol |
| Exact Mass | 310.06 |
| IUPAC Name | N,N-dibutyl-2-chloro-1,3-thiazole-5-sulfonamide |
| SMILES | CCCCN(CCCC)S(=O)(=O)c1cnc(Cl)s1 |
| InChI | InChI=1S/C11H19ClN2O2S2/c1-3-5-7-14(8-6-4-2)18(15,16)10-9-13-11(12)17-10/h9H,3-8H2,1-2H3 |
| InChIKey | MDHZNLAYTNUPPT-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.87 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |