C10H9ClN2O2S2 — CID 43427433
2-chloro-N-methyl-N-phenyl-1,3-thiazole-5-sulfonamide (PubChem CID 43427433) has the molecular formula C10H9ClN2O2S2 and a molecular weight of 288.78 g/mol. Its IUPAC name is 2-chloro-N-methyl-N-phenyl-1,3-thiazole-5-sulfonamide.
| Compound Name | 2-chloro-N-methyl-N-phenyl-1,3-thiazole-5-sulfonamide |
|---|---|
| PubChem CID | 43427433 |
| Molecular Formula | C10H9ClN2O2S2 |
| Molecular Weight | 288.78 g/mol |
| Exact Mass | 287.98 |
| IUPAC Name | 2-chloro-N-methyl-N-phenyl-1,3-thiazole-5-sulfonamide |
| SMILES | CN(c1ccccc1)S(=O)(=O)c1cnc(Cl)s1 |
| InChI | InChI=1S/C10H9ClN2O2S2/c1-13(8-5-3-2-4-6-8)17(14,15)9-7-12-10(11)16-9/h2-7H,1H3 |
| InChIKey | XXCYOFDSFKDFPB-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.78 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |