C11H11ClN2O3S2 — CID 43455847
2-chloro-N-[(2-methoxyphenyl)methyl]-1,3-thiazole-5-sulfonamide (PubChem CID 43455847) has the molecular formula C11H11ClN2O3S2 and a molecular weight of 318.81 g/mol. Its IUPAC name is 2-chloro-N-[(2-methoxyphenyl)methyl]-1,3-thiazole-5-sulfonamide.
| Compound Name | 2-chloro-N-[(2-methoxyphenyl)methyl]-1,3-thiazole-5-sulfonamide |
|---|---|
| PubChem CID | 43455847 |
| Molecular Formula | C11H11ClN2O3S2 |
| Molecular Weight | 318.81 g/mol |
| Exact Mass | 317.99 |
| IUPAC Name | 2-chloro-N-[(2-methoxyphenyl)methyl]-1,3-thiazole-5-sulfonamide |
| SMILES | COc1ccccc1CNS(=O)(=O)c1cnc(Cl)s1 |
| InChI | InChI=1S/C11H11ClN2O3S2/c1-17-9-5-3-2-4-8(9)6-14-19(15,16)10-7-13-11(12)18-10/h2-5,7,14H,6H2,1H3 |
| InChIKey | GLVMFRASMWARGK-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.81 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |