C12H13ClN2O4S2 — CID 61051507
2-chloro-N-[(2,5-dimethoxyphenyl)methyl]-1,3-thiazole-5-sulfonamide (PubChem CID 61051507) has the molecular formula C12H13ClN2O4S2 and a molecular weight of 348.83 g/mol. Its IUPAC name is 2-chloro-N-[(2,5-dimethoxyphenyl)methyl]-1,3-thiazole-5-sulfonamide.
| Compound Name | 2-chloro-N-[(2,5-dimethoxyphenyl)methyl]-1,3-thiazole-5-sulfonamide |
|---|---|
| PubChem CID | 61051507 |
| Molecular Formula | C12H13ClN2O4S2 |
| Molecular Weight | 348.83 g/mol |
| Exact Mass | 348.00 |
| IUPAC Name | 2-chloro-N-[(2,5-dimethoxyphenyl)methyl]-1,3-thiazole-5-sulfonamide |
| SMILES | COc1ccc(OC)c(CNS(=O)(=O)c2cnc(Cl)s2)c1 |
| InChI | InChI=1S/C12H13ClN2O4S2/c1-18-9-3-4-10(19-2)8(5-9)6-15-21(16,17)11-7-14-12(13)20-11/h3-5,7,15H,6H2,1-2H3 |
| InChIKey | YQUSIWRRYKPSRG-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.83 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |