C13H13Cl2NO4S2 — CID 5157003
2,5-dichloro-N-[(2,4-dimethoxyphenyl)methyl]thiophene-3-sulfonamide (PubChem CID 5157003) has the molecular formula C13H13Cl2NO4S2 and a molecular weight of 382.29 g/mol. Its IUPAC name is 2,5-dichloro-N-[(2,4-dimethoxyphenyl)methyl]thiophene-3-sulfonamide.
| Compound Name | 2,5-dichloro-N-[(2,4-dimethoxyphenyl)methyl]thiophene-3-sulfonamide |
|---|---|
| PubChem CID | 5157003 |
| Molecular Formula | C13H13Cl2NO4S2 |
| Molecular Weight | 382.29 g/mol |
| Exact Mass | 380.97 |
| IUPAC Name | 2,5-dichloro-N-[(2,4-dimethoxyphenyl)methyl]thiophene-3-sulfonamide |
| SMILES | COc1ccc(CNS(=O)(=O)c2cc(Cl)sc2Cl)c(OC)c1 |
| InChI | InChI=1S/C13H13Cl2NO4S2/c1-19-9-4-3-8(10(5-9)20-2)7-16-22(17,18)11-6-12(14)21-13(11)15/h3-6,16H,7H2,1-2H3 |
| InChIKey | CRBDRBPUEQWPLQ-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.29 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |