C13H13Cl2NO3S2 — CID 5199198
2,5-dichloro-N-[1-(4-methoxyphenyl)ethyl]thiophene-3-sulfonamide (PubChem CID 5199198) has the molecular formula C13H13Cl2NO3S2 and a molecular weight of 366.29 g/mol. Its IUPAC name is 2,5-dichloro-N-[1-(4-methoxyphenyl)ethyl]thiophene-3-sulfonamide.
| Compound Name | 2,5-dichloro-N-[1-(4-methoxyphenyl)ethyl]thiophene-3-sulfonamide |
|---|---|
| PubChem CID | 5199198 |
| Molecular Formula | C13H13Cl2NO3S2 |
| Molecular Weight | 366.29 g/mol |
| Exact Mass | 364.97 |
| IUPAC Name | 2,5-dichloro-N-[1-(4-methoxyphenyl)ethyl]thiophene-3-sulfonamide |
| SMILES | COc1ccc(C(C)NS(=O)(=O)c2cc(Cl)sc2Cl)cc1 |
| InChI | InChI=1S/C13H13Cl2NO3S2/c1-8(9-3-5-10(19-2)6-4-9)16-21(17,18)11-7-12(14)20-13(11)15/h3-8,16H,1-2H3 |
| InChIKey | VTECFIPHSIUUCG-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.29 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |