C13H11Cl2NO6S2 — CID 52863495
2-[(2,5-dichlorothiophen-3-yl)sulfonylamino]-3,5-dimethoxybenzoic acid (PubChem CID 52863495) has the molecular formula C13H11Cl2NO6S2 and a molecular weight of 412.27 g/mol. Its IUPAC name is 2-[(2,5-dichlorothiophen-3-yl)sulfonylamino]-3,5-dimethoxybenzoic acid.
| Compound Name | 2-[(2,5-dichlorothiophen-3-yl)sulfonylamino]-3,5-dimethoxybenzoic acid |
|---|---|
| PubChem CID | 52863495 |
| Molecular Formula | C13H11Cl2NO6S2 |
| Molecular Weight | 412.27 g/mol |
| Exact Mass | 410.94 |
| IUPAC Name | 2-[(2,5-dichlorothiophen-3-yl)sulfonylamino]-3,5-dimethoxybenzoic acid |
| SMILES | COc1cc(OC)c(NS(=O)(=O)c2cc(Cl)sc2Cl)c(C(=O)O)c1 |
| InChI | InChI=1S/C13H11Cl2NO6S2/c1-21-6-3-7(13(17)18)11(8(4-6)22-2)16-24(19,20)9-5-10(14)23-12(9)15/h3-5,16H,1-2H3,(H,17,18) |
| InChIKey | XFIDFHPPKRDPIP-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.27 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |