C11H10Cl2N2O3S2 — CID 43604989
N-(4-amino-3-methoxyphenyl)-2,5-dichlorothiophene-3-sulfonamide (PubChem CID 43604989) has the molecular formula C11H10Cl2N2O3S2 and a molecular weight of 353.25 g/mol. Its IUPAC name is N-(4-amino-3-methoxyphenyl)-2,5-dichlorothiophene-3-sulfonamide.
| Compound Name | N-(4-amino-3-methoxyphenyl)-2,5-dichlorothiophene-3-sulfonamide |
|---|---|
| PubChem CID | 43604989 |
| Molecular Formula | C11H10Cl2N2O3S2 |
| Molecular Weight | 353.25 g/mol |
| Exact Mass | 351.95 |
| IUPAC Name | N-(4-amino-3-methoxyphenyl)-2,5-dichlorothiophene-3-sulfonamide |
| SMILES | COc1cc(NS(=O)(=O)c2cc(Cl)sc2Cl)ccc1N |
| InChI | InChI=1S/C11H10Cl2N2O3S2/c1-18-8-4-6(2-3-7(8)14)15-20(16,17)9-5-10(12)19-11(9)13/h2-5,15H,14H2,1H3 |
| InChIKey | VGIOALJKAFVRIP-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.25 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|