C18H11Cl2NO2S2 — CID 3600344
N-anthracen-2-yl-2,5-dichlorothiophene-3-sulfonamide (PubChem CID 3600344) has the molecular formula C18H11Cl2NO2S2 and a molecular weight of 408.33 g/mol. Its IUPAC name is N-anthracen-2-yl-2,5-dichlorothiophene-3-sulfonamide.
| Compound Name | N-anthracen-2-yl-2,5-dichlorothiophene-3-sulfonamide |
|---|---|
| PubChem CID | 3600344 |
| Molecular Formula | C18H11Cl2NO2S2 |
| Molecular Weight | 408.33 g/mol |
| Exact Mass | 406.96 |
| IUPAC Name | N-anthracen-2-yl-2,5-dichlorothiophene-3-sulfonamide |
| SMILES | O=S(=O)(Nc1ccc2cc3ccccc3cc2c1)c1cc(Cl)sc1Cl |
| InChI | InChI=1S/C18H11Cl2NO2S2/c19-17-10-16(18(20)24-17)25(22,23)21-15-6-5-13-7-11-3-1-2-4-12(11)8-14(13)9-15/h1-10,21H |
| InChIKey | NKMNIOZWKXFZIL-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.33 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|