C9H5BrCl2N2O2S2 — CID 43520652
N-(6-bromo-2-pyridinyl)-2,5-dichlorothiophene-3-sulfonamide (PubChem CID 43520652) has the molecular formula C9H5BrCl2N2O2S2 and a molecular weight of 388.10 g/mol. Its IUPAC name is N-(6-bromo-2-pyridinyl)-2,5-dichlorothiophene-3-sulfonamide.
| Compound Name | N-(6-bromo-2-pyridinyl)-2,5-dichlorothiophene-3-sulfonamide |
|---|---|
| PubChem CID | 43520652 |
| Molecular Formula | C9H5BrCl2N2O2S2 |
| Molecular Weight | 388.10 g/mol |
| Exact Mass | 385.84 |
| IUPAC Name | N-(6-bromo-2-pyridinyl)-2,5-dichlorothiophene-3-sulfonamide |
| SMILES | O=S(=O)(Nc1cccc(Br)n1)c1cc(Cl)sc1Cl |
| InChI | InChI=1S/C9H5BrCl2N2O2S2/c10-6-2-1-3-8(13-6)14-18(15,16)5-4-7(11)17-9(5)12/h1-4H,(H,13,14) |
| InChIKey | CWKWARVLOLKLEH-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.10 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|