C11H9Cl2NO4S3 — CID 18289175
2,5-dichloro-N-(3-methylsulfonylphenyl)thiophene-3-sulfonamide (PubChem CID 18289175) has the molecular formula C11H9Cl2NO4S3 and a molecular weight of 386.30 g/mol. Its IUPAC name is 2,5-dichloro-N-(3-methylsulfonylphenyl)thiophene-3-sulfonamide.
| Compound Name | 2,5-dichloro-N-(3-methylsulfonylphenyl)thiophene-3-sulfonamide |
|---|---|
| PubChem CID | 18289175 |
| Molecular Formula | C11H9Cl2NO4S3 |
| Molecular Weight | 386.30 g/mol |
| Exact Mass | 384.91 |
| IUPAC Name | 2,5-dichloro-N-(3-methylsulfonylphenyl)thiophene-3-sulfonamide |
| SMILES | CS(=O)(=O)c1cccc(NS(=O)(=O)c2cc(Cl)sc2Cl)c1 |
| InChI | InChI=1S/C11H9Cl2NO4S3/c1-20(15,16)8-4-2-3-7(5-8)14-21(17,18)9-6-10(12)19-11(9)13/h2-6,14H,1H3 |
| InChIKey | SXZWJCSJGVCMEU-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.30 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |