C10H6Cl2FNO3S2 — CID 64781655
2,5-dichloro-N-(3-fluoro-4-hydroxyphenyl)thiophene-3-sulfonamide (PubChem CID 64781655) has the molecular formula C10H6Cl2FNO3S2 and a molecular weight of 342.20 g/mol. Its IUPAC name is 2,5-dichloro-N-(3-fluoro-4-hydroxyphenyl)thiophene-3-sulfonamide.
| Compound Name | 2,5-dichloro-N-(3-fluoro-4-hydroxyphenyl)thiophene-3-sulfonamide |
|---|---|
| PubChem CID | 64781655 |
| Molecular Formula | C10H6Cl2FNO3S2 |
| Molecular Weight | 342.20 g/mol |
| Exact Mass | 340.92 |
| IUPAC Name | 2,5-dichloro-N-(3-fluoro-4-hydroxyphenyl)thiophene-3-sulfonamide |
| SMILES | O=S(=O)(Nc1ccc(O)c(F)c1)c1cc(Cl)sc1Cl |
| InChI | InChI=1S/C10H6Cl2FNO3S2/c11-9-4-8(10(12)18-9)19(16,17)14-5-1-2-7(15)6(13)3-5/h1-4,14-15H |
| InChIKey | TWMCRCTXJYRVIO-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.20 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfonamide_B(41)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|