C10H7Cl3N2O2S2 — CID 43604417
N-(4-amino-3-chlorophenyl)-2,5-dichlorothiophene-3-sulfonamide (PubChem CID 43604417) has the molecular formula C10H7Cl3N2O2S2 and a molecular weight of 357.67 g/mol. Its IUPAC name is N-(4-amino-3-chlorophenyl)-2,5-dichlorothiophene-3-sulfonamide.
| Compound Name | N-(4-amino-3-chlorophenyl)-2,5-dichlorothiophene-3-sulfonamide |
|---|---|
| PubChem CID | 43604417 |
| Molecular Formula | C10H7Cl3N2O2S2 |
| Molecular Weight | 357.67 g/mol |
| Exact Mass | 355.90 |
| IUPAC Name | N-(4-amino-3-chlorophenyl)-2,5-dichlorothiophene-3-sulfonamide |
| SMILES | Nc1ccc(NS(=O)(=O)c2cc(Cl)sc2Cl)cc1Cl |
| InChI | InChI=1S/C10H7Cl3N2O2S2/c11-6-3-5(1-2-7(6)14)15-19(16,17)8-4-9(12)18-10(8)13/h1-4,15H,14H2 |
| InChIKey | BKPPBJFWDOGKOK-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.67 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|