C14H12Cl3N3O3S2 — CID 55662919
2,5-dichloro-N-[3-chloro-4-(3-oxopiperazin-1-yl)phenyl]thiophene-3-sulfonamide (PubChem CID 55662919) has the molecular formula C14H12Cl3N3O3S2 and a molecular weight of 440.76 g/mol. Its IUPAC name is 2,5-dichloro-N-[3-chloro-4-(3-oxopiperazin-1-yl)phenyl]thiophene-3-sulfonamide.
| Compound Name | 2,5-dichloro-N-[3-chloro-4-(3-oxopiperazin-1-yl)phenyl]thiophene-3-sulfonamide |
|---|---|
| PubChem CID | 55662919 |
| Molecular Formula | C14H12Cl3N3O3S2 |
| Molecular Weight | 440.76 g/mol |
| Exact Mass | 438.94 |
| IUPAC Name | 2,5-dichloro-N-[3-chloro-4-(3-oxopiperazin-1-yl)phenyl]thiophene-3-sulfonamide |
| SMILES | O=C1CN(c2ccc(NS(=O)(=O)c3cc(Cl)sc3Cl)cc2Cl)CCN1 |
| InChI | InChI=1S/C14H12Cl3N3O3S2/c15-9-5-8(1-2-10(9)20-4-3-18-13(21)7-20)19-25(22,23)11-6-12(16)24-14(11)17/h1-2,5-6,19H,3-4,7H2,(H,18,21) |
| InChIKey | DDYFVVLVJMKSPZ-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.76 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|