C21H24ClN3O2S — CID 71896620
N-[3-chloro-4-(3-oxopiperazin-1-yl)phenyl]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-2-carboxamide (PubChem CID 71896620) has the molecular formula C21H24ClN3O2S and a molecular weight of 417.96 g/mol. Its IUPAC name is N-[3-chloro-4-(3-oxopiperazin-1-yl)phenyl]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-2-carboxamide.
| Compound Name | N-[3-chloro-4-(3-oxopiperazin-1-yl)phenyl]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 71896620 |
| Molecular Formula | C21H24ClN3O2S |
| Molecular Weight | 417.96 g/mol |
| Exact Mass | 417.13 |
| IUPAC Name | N-[3-chloro-4-(3-oxopiperazin-1-yl)phenyl]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-2-carboxamide |
| SMILES | O=C1CN(c2ccc(NC(=O)c3cc4c(s3)CCCCCC4)cc2Cl)CCN1 |
| InChI | InChI=1S/C21H24ClN3O2S/c22-16-12-15(7-8-17(16)25-10-9-23-20(26)13-25)24-21(27)19-11-14-5-3-1-2-4-6-18(14)28-19/h7-8,11-12H,1-6,9-10,13H2,(H,23,26)(H,24,27) |
| InChIKey | VRBHFISAWLVSDV-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.96 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|