C19H21ClN4O6S — CID 46485397
N-[3-chloro-4-(3-oxopiperazin-1-yl)phenyl]-5-morpholin-4-ylsulfonylfuran-2-carboxamide (PubChem CID 46485397) has the molecular formula C19H21ClN4O6S and a molecular weight of 468.92 g/mol. Its IUPAC name is N-[3-chloro-4-(3-oxopiperazin-1-yl)phenyl]-5-morpholin-4-ylsulfonylfuran-2-carboxamide.
| Compound Name | N-[3-chloro-4-(3-oxopiperazin-1-yl)phenyl]-5-morpholin-4-ylsulfonylfuran-2-carboxamide |
|---|---|
| PubChem CID | 46485397 |
| Molecular Formula | C19H21ClN4O6S |
| Molecular Weight | 468.92 g/mol |
| Exact Mass | 468.09 |
| IUPAC Name | N-[3-chloro-4-(3-oxopiperazin-1-yl)phenyl]-5-morpholin-4-ylsulfonylfuran-2-carboxamide |
| SMILES | O=C1CN(c2ccc(NC(=O)c3ccc(S(=O)(=O)N4CCOCC4)o3)cc2Cl)CCN1 |
| InChI | InChI=1S/C19H21ClN4O6S/c20-14-11-13(1-2-15(14)23-6-5-21-17(25)12-23)22-19(26)16-3-4-18(30-16)31(27,28)24-7-9-29-10-8-24/h1-4,11H,5-10,12H2,(H,21,25)(H,22,26) |
| InChIKey | YJFKDTGMCWECCS-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 121.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.92 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|