C23H20ClN5O3 — CID 55763705
N-[3-[[3-chloro-4-(3-oxopiperazin-1-yl)phenyl]carbamoyl]phenyl]pyridine-3-carboxamide (PubChem CID 55763705) has the molecular formula C23H20ClN5O3 and a molecular weight of 449.90 g/mol. Its IUPAC name is N-[3-[[3-chloro-4-(3-oxopiperazin-1-yl)phenyl]carbamoyl]phenyl]pyridine-3-carboxamide.
| Compound Name | N-[3-[[3-chloro-4-(3-oxopiperazin-1-yl)phenyl]carbamoyl]phenyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 55763705 |
| Molecular Formula | C23H20ClN5O3 |
| Molecular Weight | 449.90 g/mol |
| Exact Mass | 449.13 |
| IUPAC Name | N-[3-[[3-chloro-4-(3-oxopiperazin-1-yl)phenyl]carbamoyl]phenyl]pyridine-3-carboxamide |
| SMILES | O=C1CN(c2ccc(NC(=O)c3cccc(NC(=O)c4cccnc4)c3)cc2Cl)CCN1 |
| InChI | InChI=1S/C23H20ClN5O3/c24-19-12-18(6-7-20(19)29-10-9-26-21(30)14-29)28-22(31)15-3-1-5-17(11-15)27-23(32)16-4-2-8-25-13-16/h1-8,11-13H,9-10,14H2,(H,26,30)(H,27,32)(H,28,31) |
| InChIKey | CKYVTBCVIMCLBG-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 103.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.90 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|