C18H15Cl2F3N4O3 — CID 55763398
5-chloro-N-[3-chloro-4-(3-oxopiperazin-1-yl)phenyl]-6-(2,2,2-trifluoroethoxy)pyridine-3-carboxamide (PubChem CID 55763398) has the molecular formula C18H15Cl2F3N4O3 and a molecular weight of 463.24 g/mol. Its IUPAC name is 5-chloro-N-[3-chloro-4-(3-oxopiperazin-1-yl)phenyl]-6-(2,2,2-trifluoroethoxy)pyridine-3-carboxamide.
| Compound Name | 5-chloro-N-[3-chloro-4-(3-oxopiperazin-1-yl)phenyl]-6-(2,2,2-trifluoroethoxy)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 55763398 |
| Molecular Formula | C18H15Cl2F3N4O3 |
| Molecular Weight | 463.24 g/mol |
| Exact Mass | 462.05 |
| IUPAC Name | 5-chloro-N-[3-chloro-4-(3-oxopiperazin-1-yl)phenyl]-6-(2,2,2-trifluoroethoxy)pyridine-3-carboxamide |
| SMILES | O=C1CN(c2ccc(NC(=O)c3cnc(OCC(F)(F)F)c(Cl)c3)cc2Cl)CCN1 |
| InChI | InChI=1S/C18H15Cl2F3N4O3/c19-12-6-11(1-2-14(12)27-4-3-24-15(28)8-27)26-16(29)10-5-13(20)17(25-7-10)30-9-18(21,22)23/h1-2,5-7H,3-4,8-9H2,(H,24,28)(H,26,29) |
| InChIKey | KRKGAABTEAOFHR-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.24 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|