C22H23ClN4O3 — CID 46467787
N-[3-chloro-4-(3-oxopiperazin-1-yl)phenyl]-3-[(2-methylcyclopropanecarbonyl)amino]benzamide (PubChem CID 46467787) has the molecular formula C22H23ClN4O3 and a molecular weight of 426.90 g/mol. Its IUPAC name is N-[3-chloro-4-(3-oxopiperazin-1-yl)phenyl]-3-[(2-methylcyclopropanecarbonyl)amino]benzamide.
| Compound Name | N-[3-chloro-4-(3-oxopiperazin-1-yl)phenyl]-3-[(2-methylcyclopropanecarbonyl)amino]benzamide |
|---|---|
| PubChem CID | 46467787 |
| Molecular Formula | C22H23ClN4O3 |
| Molecular Weight | 426.90 g/mol |
| Exact Mass | 426.15 |
| IUPAC Name | N-[3-chloro-4-(3-oxopiperazin-1-yl)phenyl]-3-[(2-methylcyclopropanecarbonyl)amino]benzamide |
| SMILES | CC1CC1C(=O)Nc1cccc(C(=O)Nc2ccc(N3CCNC(=O)C3)c(Cl)c2)c1 |
| InChI | InChI=1S/C22H23ClN4O3/c1-13-9-17(13)22(30)26-15-4-2-3-14(10-15)21(29)25-16-5-6-19(18(23)11-16)27-8-7-24-20(28)12-27/h2-6,10-11,13,17H,7-9,12H2,1H3,(H,24,28)(H,25,29)(H,26,30) |
| InChIKey | SRMZSPILRQGAFW-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.90 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|