C12H8Br2FNO3S — CID 64781653
2,5-dibromo-N-(3-fluoro-4-hydroxyphenyl)benzenesulfonamide (PubChem CID 64781653) has the molecular formula C12H8Br2FNO3S and a molecular weight of 425.07 g/mol. Its IUPAC name is 2,5-dibromo-N-(3-fluoro-4-hydroxyphenyl)benzenesulfonamide.
| Compound Name | 2,5-dibromo-N-(3-fluoro-4-hydroxyphenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 64781653 |
| Molecular Formula | C12H8Br2FNO3S |
| Molecular Weight | 425.07 g/mol |
| Exact Mass | 422.86 |
| IUPAC Name | 2,5-dibromo-N-(3-fluoro-4-hydroxyphenyl)benzenesulfonamide |
| SMILES | O=S(=O)(Nc1ccc(O)c(F)c1)c1cc(Br)ccc1Br |
| InChI | InChI=1S/C12H8Br2FNO3S/c13-7-1-3-9(14)12(5-7)20(18,19)16-8-2-4-11(17)10(15)6-8/h1-6,16-17H |
| InChIKey | XTCDYBARIGQAHL-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.07 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulfonamide_B(41)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|