C13H9Br2F2NO3S — CID 26980608
2,5-dibromo-N-[4-(difluoromethoxy)phenyl]benzenesulfonamide (PubChem CID 26980608) has the molecular formula C13H9Br2F2NO3S and a molecular weight of 457.09 g/mol. Its IUPAC name is 2,5-dibromo-N-[4-(difluoromethoxy)phenyl]benzenesulfonamide.
| Compound Name | 2,5-dibromo-N-[4-(difluoromethoxy)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 26980608 |
| Molecular Formula | C13H9Br2F2NO3S |
| Molecular Weight | 457.09 g/mol |
| Exact Mass | 454.86 |
| IUPAC Name | 2,5-dibromo-N-[4-(difluoromethoxy)phenyl]benzenesulfonamide |
| SMILES | O=S(=O)(Nc1ccc(OC(F)F)cc1)c1cc(Br)ccc1Br |
| InChI | InChI=1S/C13H9Br2F2NO3S/c14-8-1-6-11(15)12(7-8)22(19,20)18-9-2-4-10(5-3-9)21-13(16)17/h1-7,13,18H |
| InChIKey | PPMDRWFCHVIERQ-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.09 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |