C13H8F5NO3S — CID 2542290
N-[4-(difluoromethoxy)phenyl]-2,3,4-trifluorobenzenesulfonamide (PubChem CID 2542290) has the molecular formula C13H8F5NO3S and a molecular weight of 353.27 g/mol. Its IUPAC name is N-[4-(difluoromethoxy)phenyl]-2,3,4-trifluorobenzenesulfonamide.
| Compound Name | N-[4-(difluoromethoxy)phenyl]-2,3,4-trifluorobenzenesulfonamide |
|---|---|
| PubChem CID | 2542290 |
| Molecular Formula | C13H8F5NO3S |
| Molecular Weight | 353.27 g/mol |
| Exact Mass | 353.01 |
| IUPAC Name | N-[4-(difluoromethoxy)phenyl]-2,3,4-trifluorobenzenesulfonamide |
| SMILES | O=S(=O)(Nc1ccc(OC(F)F)cc1)c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C13H8F5NO3S/c14-9-5-6-10(12(16)11(9)15)23(20,21)19-7-1-3-8(4-2-7)22-13(17)18/h1-6,13,19H |
| InChIKey | HMBMODMEZPCGPF-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.27 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|