C13H7F6NO3S — CID 4846605
2,3,4-trifluoro-N-[4-(trifluoromethoxy)phenyl]benzenesulfonamide (PubChem CID 4846605) has the molecular formula C13H7F6NO3S and a molecular weight of 371.26 g/mol. Its IUPAC name is 2,3,4-trifluoro-N-[4-(trifluoromethoxy)phenyl]benzenesulfonamide.
| Compound Name | 2,3,4-trifluoro-N-[4-(trifluoromethoxy)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 4846605 |
| Molecular Formula | C13H7F6NO3S |
| Molecular Weight | 371.26 g/mol |
| Exact Mass | 371.01 |
| IUPAC Name | 2,3,4-trifluoro-N-[4-(trifluoromethoxy)phenyl]benzenesulfonamide |
| SMILES | O=S(=O)(Nc1ccc(OC(F)(F)F)cc1)c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C13H7F6NO3S/c14-9-5-6-10(12(16)11(9)15)24(21,22)20-7-1-3-8(4-2-7)23-13(17,18)19/h1-6,20H |
| InChIKey | MDQGIOODYPOUTG-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.26 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|