C15H13F3N2O4S2 — CID 24602915
N-[4-(cyclopropylsulfamoyl)phenyl]-2,3,4-trifluorobenzenesulfonamide (PubChem CID 24602915) has the molecular formula C15H13F3N2O4S2 and a molecular weight of 406.41 g/mol. Its IUPAC name is N-[4-(cyclopropylsulfamoyl)phenyl]-2,3,4-trifluorobenzenesulfonamide.
| Compound Name | N-[4-(cyclopropylsulfamoyl)phenyl]-2,3,4-trifluorobenzenesulfonamide |
|---|---|
| PubChem CID | 24602915 |
| Molecular Formula | C15H13F3N2O4S2 |
| Molecular Weight | 406.41 g/mol |
| Exact Mass | 406.03 |
| IUPAC Name | N-[4-(cyclopropylsulfamoyl)phenyl]-2,3,4-trifluorobenzenesulfonamide |
| SMILES | O=S(=O)(NC1CC1)c1ccc(NS(=O)(=O)c2ccc(F)c(F)c2F)cc1 |
| InChI | InChI=1S/C15H13F3N2O4S2/c16-12-7-8-13(15(18)14(12)17)26(23,24)20-10-3-5-11(6-4-10)25(21,22)19-9-1-2-9/h3-9,19-20H,1-2H2 |
| InChIKey | HLMAPNOZUNDSKP-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.41 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|