C12H9F3N2O4S2 — CID 26951370
2,3,4-trifluoro-N-(4-sulfamoylphenyl)benzenesulfonamide (PubChem CID 26951370) has the molecular formula C12H9F3N2O4S2 and a molecular weight of 366.34 g/mol. Its IUPAC name is 2,3,4-trifluoro-N-(4-sulfamoylphenyl)benzenesulfonamide.
| Compound Name | 2,3,4-trifluoro-N-(4-sulfamoylphenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 26951370 |
| Molecular Formula | C12H9F3N2O4S2 |
| Molecular Weight | 366.34 g/mol |
| Exact Mass | 366.00 |
| IUPAC Name | 2,3,4-trifluoro-N-(4-sulfamoylphenyl)benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(NS(=O)(=O)c2ccc(F)c(F)c2F)cc1 |
| InChI | InChI=1S/C12H9F3N2O4S2/c13-9-5-6-10(12(15)11(9)14)23(20,21)17-7-1-3-8(4-2-7)22(16,18)19/h1-6,17H,(H2,16,18,19) |
| InChIKey | JAVKTBGRCNVOQN-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.34 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|