C15H12F3NO4S — CID 55729419
N-(2,2-dimethyl-1,3-benzodioxol-5-yl)-2,3,4-trifluorobenzenesulfonamide (PubChem CID 55729419) has the molecular formula C15H12F3NO4S and a molecular weight of 359.33 g/mol. Its IUPAC name is N-(2,2-dimethyl-1,3-benzodioxol-5-yl)-2,3,4-trifluorobenzenesulfonamide.
| Compound Name | N-(2,2-dimethyl-1,3-benzodioxol-5-yl)-2,3,4-trifluorobenzenesulfonamide |
|---|---|
| PubChem CID | 55729419 |
| Molecular Formula | C15H12F3NO4S |
| Molecular Weight | 359.33 g/mol |
| Exact Mass | 359.04 |
| IUPAC Name | N-(2,2-dimethyl-1,3-benzodioxol-5-yl)-2,3,4-trifluorobenzenesulfonamide |
| SMILES | CC1(C)Oc2ccc(NS(=O)(=O)c3ccc(F)c(F)c3F)cc2O1 |
| InChI | InChI=1S/C15H12F3NO4S/c1-15(2)22-10-5-3-8(7-11(10)23-15)19-24(20,21)12-6-4-9(16)13(17)14(12)18/h3-7,19H,1-2H3 |
| InChIKey | RUFQAMRLBMISON-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.33 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|