C14H9F6NO3S — CID 3778972
2,3,4-trifluoro-N-[4-methoxy-3-(trifluoromethyl)phenyl]benzenesulfonamide (PubChem CID 3778972) has the molecular formula C14H9F6NO3S and a molecular weight of 385.29 g/mol. Its IUPAC name is 2,3,4-trifluoro-N-[4-methoxy-3-(trifluoromethyl)phenyl]benzenesulfonamide.
| Compound Name | 2,3,4-trifluoro-N-[4-methoxy-3-(trifluoromethyl)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 3778972 |
| Molecular Formula | C14H9F6NO3S |
| Molecular Weight | 385.29 g/mol |
| Exact Mass | 385.02 |
| IUPAC Name | 2,3,4-trifluoro-N-[4-methoxy-3-(trifluoromethyl)phenyl]benzenesulfonamide |
| SMILES | COc1ccc(NS(=O)(=O)c2ccc(F)c(F)c2F)cc1C(F)(F)F |
| InChI | InChI=1S/C14H9F6NO3S/c1-24-10-4-2-7(6-8(10)14(18,19)20)21-25(22,23)11-5-3-9(15)12(16)13(11)17/h2-6,21H,1H3 |
| InChIKey | VVVSXBPJOLKXIT-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.29 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|