C15H11F6NO4S — CID 3841687
N-[4-methoxy-3-(trifluoromethyl)phenyl]-2-(trifluoromethoxy)benzenesulfonamide (PubChem CID 3841687) has the molecular formula C15H11F6NO4S and a molecular weight of 415.31 g/mol. Its IUPAC name is N-[4-methoxy-3-(trifluoromethyl)phenyl]-2-(trifluoromethoxy)benzenesulfonamide.
| Compound Name | N-[4-methoxy-3-(trifluoromethyl)phenyl]-2-(trifluoromethoxy)benzenesulfonamide |
|---|---|
| PubChem CID | 3841687 |
| Molecular Formula | C15H11F6NO4S |
| Molecular Weight | 415.31 g/mol |
| Exact Mass | 415.03 |
| IUPAC Name | N-[4-methoxy-3-(trifluoromethyl)phenyl]-2-(trifluoromethoxy)benzenesulfonamide |
| SMILES | COc1ccc(NS(=O)(=O)c2ccccc2OC(F)(F)F)cc1C(F)(F)F |
| InChI | InChI=1S/C15H11F6NO4S/c1-25-11-7-6-9(8-10(11)14(16,17)18)22-27(23,24)13-5-3-2-4-12(13)26-15(19,20)21/h2-8,22H,1H3 |
| InChIKey | FCZZDLWWZWSZTI-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.31 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |