C16H14F3NO6S — CID 3811980
methyl 2-methoxy-4-[[2-(trifluoromethoxy)phenyl]sulfonylamino]benzoate (PubChem CID 3811980) has the molecular formula C16H14F3NO6S and a molecular weight of 405.35 g/mol. Its IUPAC name is methyl 2-methoxy-4-[[2-(trifluoromethoxy)phenyl]sulfonylamino]benzoate.
| Compound Name | methyl 2-methoxy-4-[[2-(trifluoromethoxy)phenyl]sulfonylamino]benzoate |
|---|---|
| PubChem CID | 3811980 |
| Molecular Formula | C16H14F3NO6S |
| Molecular Weight | 405.35 g/mol |
| Exact Mass | 405.05 |
| IUPAC Name | methyl 2-methoxy-4-[[2-(trifluoromethoxy)phenyl]sulfonylamino]benzoate |
| SMILES | COC(=O)c1ccc(NS(=O)(=O)c2ccccc2OC(F)(F)F)cc1OC |
| InChI | InChI=1S/C16H14F3NO6S/c1-24-13-9-10(7-8-11(13)15(21)25-2)20-27(22,23)14-6-4-3-5-12(14)26-16(17,18)19/h3-9,20H,1-2H3 |
| InChIKey | NMAGKIPNLFVNBL-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.35 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |