C18H19F3N2O3S — CID 78836615
N-(3-methyl-4-pyrrolidin-1-ylphenyl)-2-(trifluoromethoxy)benzenesulfonamide (PubChem CID 78836615) has the molecular formula C18H19F3N2O3S and a molecular weight of 400.42 g/mol. Its IUPAC name is N-(3-methyl-4-pyrrolidin-1-ylphenyl)-2-(trifluoromethoxy)benzenesulfonamide.
| Compound Name | N-(3-methyl-4-pyrrolidin-1-ylphenyl)-2-(trifluoromethoxy)benzenesulfonamide |
|---|---|
| PubChem CID | 78836615 |
| Molecular Formula | C18H19F3N2O3S |
| Molecular Weight | 400.42 g/mol |
| Exact Mass | 400.11 |
| IUPAC Name | N-(3-methyl-4-pyrrolidin-1-ylphenyl)-2-(trifluoromethoxy)benzenesulfonamide |
| SMILES | Cc1cc(NS(=O)(=O)c2ccccc2OC(F)(F)F)ccc1N1CCCC1 |
| InChI | InChI=1S/C18H19F3N2O3S/c1-13-12-14(8-9-15(13)23-10-4-5-11-23)22-27(24,25)17-7-3-2-6-16(17)26-18(19,20)21/h2-3,6-9,12,22H,4-5,10-11H2,1H3 |
| InChIKey | OJQMRDROTQNGNC-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.42 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|